Bai tap trac nghiem hoa huu co 11

Hoanghanh(2 tài liệu)
(0 người theo dõi)
Lượt xem 7
Tải xuống 3,000₫
(Lịch sử tải xuống)
Số trang: 60 | Loại file: DOC

Gửi bình luận

Bình luận

Thông tin tài liệu

Ngày đăng: 22/02/2014, 21:45

Mô tả: đầy đủ các dạng bt trắc nghiệm về các dãy hidrocacbon lớp 11 NGUYỄN MINH TUẤNGiáo viên trường THPT Chuyên Hùng VươngBÀI TẬP TRẮC NGHIỆM HOÁ HỮU CƠ 11 1MỤC LỤC TrangPhần 1: Bài tập 2 - 62Chuyên đề 1 : Đại cương hoá hữu cơ 2 Chuyên đề 2 : Hiđrocacbon no 10 Chuyên đề 3 : Hiđrocacbon không no 16 Chuyên đề 4 : Hiđrocacbon thơm - Nguồn hiđrocacbon 29 thiên nhiên Chuyên đề 5 : Dẫn xuất halogen - Phenol - Ancol 35 Chuyên đề 6 : Anđehit - Xeton - Axitcacboxylic 49 Phần 2 : Đáp án 63- 65 2Phần 1: Bài tậpCHUYÊN ĐỀ 1 : ĐẠI CƯƠNG HÓA HỌC HỮU CƠCâu 1: Thành phần các nguyên tố trong hợp chất hữu cơA. nhất thiết phải có cacbon, thường có H, hay gặp O, N sau đó đến halogen, S, P B. gồm có C, H và các nguyên tố khác.C. bao gồm tất cả các nguyên tố trong bảng tuần hoàn.D. thường có C, H hay gặp O, N, sau đó đến halogen, S, P.Câu 2: Đặc điểm chung của các phân tử hợp chất hữu cơ là1. thành phần nguyên tố chủ yếu là C và H. 2. có thể chứa nguyên tố khác như Cl, N, P, O.3. liên kết hóa học chủ yếu là liên kết cộng hoá trị. 4. liên kết hoá học chủ yếu là liên kết ion.5. dễ bay hơi, khó cháy. 6. phản ứng hoá học xảy ra nhanh.Nhóm các ý đúng là:A. 4, 5, 6. B. 1, 2, 3. C. 1, 3, 5. D. 2, 4, 6.Câu 3: Cấu tạo hoá học là A. số lượng liên kết giữa các nguyên tử trong phân tử.B. các loại liên kết giữa các nguyên tử trong phân tử.C. thứ tự liên kết giữa các nguyên tử trong phân tử.D. bản chất liên kết giữa các nguyên tử trong phân tử.Câu 4: Phát biểu nào sau được dùng để định nghĩa công thức đơn giản nhất của hợp chất hữu cơ ?A. Công thức đơn giản nhất là công thức biểu thị số nguyên tử của mỗi nguyên tố trong phân tử.B. Công thức đơn giản nhất là công thức biểu thị tỉ lệ tối giản về số nguyên tử của các nguyên tố trong phân tử.C. Công thức đơn giản nhất là công thức biểu thị tỉ lệ phần trăm số mol của mỗi nguyên tố trong phân tử.D. Công thức đơn giản nhất là công thức biểu thị tỉ lệ số nguyên tử C và H có trong phân tử.Câu 5: Cho chất axetilen (C2H2) và benzen (C6H6), hãy chọn nhận xét đúng trong các nhận xét sau :A. Hai chất đó giống nhau về công thức phân tử và khác nhau về công thức đơn giản nhất.B. Hai chất đó khác nhau về công thức phân tử và giống nhau về công thức đơn giản nhất.C. Hai chất đó khác nhau về công thức phân tử và khác nhau về công thức đơn giản nhất.D. Hai chất đó có cùng công thức phân tử và cùng công thức đơn giản nhất.Câu 6: Đặc điểm chung của các cacbocation và cacbanion là:A. kém bền và có khả năng phản ứng rất kém.B. chúng đều rất bền vững và có khả năng phản ứng cao.C. có thể dễ dàng tách được ra khỏi hỗn hợp phản ứng.D. kém bền và có khả năng phản ứng cao.Câu 7: Phản ứng hóa học của các hợp chất hữu cơ có đặc điểm là:A. thường xảy ra rất nhanh và cho một sản phẩm duy nhất.B. thường xảy ra chậm, không hoàn toàn, không theo một hướng nhất định.C. thường xảy ra rất nhanh, không hoàn toàn, không theo một hướng nhất định.D. thường xảy ra rất chậm, nhưng hoàn toàn, không theo một hướng xác định.Câu 8: Phát biểu nào sau đây là sai ?A. Liên kết hóa học chủ yếu trong hợp chất hữu cơ là liên kết cộng hóa trị.B. Các chất có cấu tạo và tính chất tương tự nhau nhưng về thành phần phân tử khác nhau một hay nhiều nhóm -CH2- là đồng đẳng của nhau.C. Các chất có cùng khối lượng phân tử là đồng phân của nhau.D. Liên kết ba gồm hai liên kết π và một liên kết σ.Câu 9: Kết luận nào sau đây là đúng ?A. Các nguyên tử trong phân tử hợp chất hữu cơ liên kết với nhau không theo một thứ tự nhất định.B. Các chất có thành phần phân tử hơn kém nhau một hay nhiều nhóm -CH2-, do đó tính chất hóa học khác nhau là những chất đồng đẳng. 3C. Các chất có cùng công thức phân tử nhưng khác nhau về công thức cấu tạo được gọi là các chất đồng đẳng của nhau.D. Các chất khác nhau có cùng công thức phân tử được gọi là các chất đồng phân của nhau.Câu 10: Hiện tượng các chất có cấu tạo và tính chất hoá học tương tự nhau, chúng chỉ hơn kém nhau một hay nhiều nhóm metylen (-CH2-) được gọi là hiện tượngA. đồng phân. B. đồng vị. C. đồng đẳng. D. đồng khối.Câu 11: Hợp chất chứa một liên kết π trong phân tử thuộc loại hợp chấtA. không no. B. mạch hở. C. thơm. D. no hoặc không no.Câu 12: Hợp chất hữu cơ được phân loại như sau: A. Hiđrocacbon và hợp chất hữu cơ có nhóm chức.B. Hiđrocacbon và dẫn xuất của hiđrocacbon.C. Hiđrocacbon no, không no, thơm và dẫn xuất của hiđrocacbon. D. Tất cả đều đúng.Câu 13: Phát biểu không chính xác là:A. Tính chất của các chất phụ thuộc vào thành phần phân tử và cấu tạo hóa học.B. Các chất có cùng khối lượng phân tử là đồng phân của nhau.C. Các chất là đồng phân của nhau thì có cùng công thức phân tử.D. Sự xen phủ trục tạo thành liên kết σ, sự xen phủ bên tạo thành liên kết π.Câu 14: Nung một hợp chất hữu cơ X với lượng dư chất oxi hóa CuO người ta thấy thoát ra khí CO2, hơi H2O và khí N2. Chọn kết luận chính xác nhất trong các kết luận sau :A. X chắc chắn chứa C, H, N và có thể có hoặc không có oxi.B. X là hợp chất của 3 nguyên tố C, H, N.C. Chất X chắc chắn có chứa C, H, có thể có N.D. X là hợp chất của 4 nguyên tố C, H, N, O.Câu 15: Cho hỗn hợp các ankan sau : pentan (sôi ở 36oC), heptan (sôi ở 98oC), octan (sôi ở 126oC), nonan (sôi ở 151oC). Có thể tách riêng các chất đó bằng cách nào sau đây ?A. Kết tinh. B. Chưng cất C. Thăng hoa. D. Chiết.Câu 16: Các chất trong nhóm chất nào dưới đây đều là dẫn xuất của hiđrocacbon ?A. CH2Cl2, CH2Br-CH2Br, NaCl, CH3Br, CH3CH2Br.B. CH2Cl2, CH2Br-CH2Br, CH3Br, CH2=CHCOOH, CH3CH2OH.C. CH2Br-CH2Br, CH2=CHBr, CH3Br, CH3CH3.D. HgCl2, CH2Br-CH2Br, CH2=CHBr, CH3CH2Br.Câu 17: Cho các chất : C6H5OH (X) ; C6H5CH2OH (Y) ; HOC6H4OH (Z) ; C6H5CH2CH2OH (T). Các chất đồng đẳng của nhau là:A. Y, T. B. X, Z, T. C. X, Z. D. Y, Z.Câu 18: Trong những dãy chất sau đây, dãy nào có các chất là đồng phân của nhau ?A. C2H5OH, CH3OCH3. B. CH3OCH3, CH3CHO.C. CH3CH2CH2OH, C2H5OH. D. C4H10, C6H6.Câu 19: Các chất hữu cơ đơn chức Z1, Z2, Z3 có CTPT tương ứng là CH2O, CH2O2, C2H4O2. Chúng thuộc các dãy đồng đẳng khác nhau. Công thức cấu tạo của Z3 làA. CH3COOCH3. B. HOCH2CHO. C. CH3COOH. D. CH3OCHO.Câu 20: Những chất nào sau đây là đồng phân hình học của nhau ?A. (I), (II). B. (I), (III). C. (II), (III). D. (I), (II), (III).Câu 21: Cho các chất sau : CH2=CHC≡CH (1) ; CH2=CHCl (2) ; CH3CH=C(CH3)2 (3) ; CH3CH=CHCH=CH2 (4) ; CH2=CHCH=CH2 (5) ; CH3CH=CHBr (6). Chất nào sau đây có đồng phân hình học?A. 2, 4, 5, 6. B. 4, 6. C. 2, 4, 6. D. 1, 3, 4. 4Câu 22: Hợp chất hữu cơ nào sau đây không có đồng phân cis-trans ?A. 1,2-đicloeten. B. 2-metyl pent-2-en. C. but-2-en. D. pent-2-en.Câu 23: Hợp chất (CH3)2C=CHC(CH3)2CH=CHBr có danh pháp IUPAC làA. 1-brom-3,5-trimetylhexa-1,4-đien. B. 3,3,5-trimetylhexa-1,4-đien-1-brom.C. 2,4,4-trimetylhexa-2,5-đien-6-brom. D. 1-brom-3,3,5-trimetylhexa-1,4-đien.Câu 24: Hợp chất (CH3)2C=CH-C(CH3)3 có danh pháp IUPAC là:A. 2,2,4- trimetylpent-3-en. B. 2,4-trimetylpent-2-en.C. 2,4,4-trimetylpent-2-en. D. 2,4-trimetylpent-3-en.Câu 25: Hợp chất CH2=CHC(CH3)2CH2CH(OH)CH3 có danh pháp IUPAC là:A. 1,3,3-trimetylpent-4-en-1-ol. B. 3,3,5-trimetylpent-1-en-5-ol.C. 4,4-đimetylhex-5-en-2-ol. D. 3,3-đimetylhex-1-en-5-ol.Câu 26: Cho công thức cấu tạo sau : CH3CH(OH)CH=C(Cl)CHO. Số oxi hóa của các nguyên tử cacbon tính từ phái sang trái có giá trị lần lượt là:A. +1 ; +1 ; -1 ; 0 ; -3. B. +1 ; -1 ; -1 ; 0 ; -3.C. +1 ; +1 ; 0 ; -1 ; +3. D. +1 ; -1 ; 0 ; -1 ; +3.Câu 27: Trong công thức CxHyOzNt tổng số liên kết π và vòng là:A. (2x-y + t+2)/2. B. (2x-y + t+2). C. (2x-y - t+2)/2. D. (2x-y + z + t+2)/2.Câu 28: a. Vitamin A công thức phân tử C20H30O, có chứa 1 vòng 6 cạnh và không có chứa liên kết ba. Số liên kết đôi trong phân tử vitamin A làA. 7. B. 6. C. 5. D. 4.b. Licopen, công thức phân tử C40H56 là chất màu đỏ trong quả cà chua, chỉ chứa liên kết đôi và liên kết đơn trong phân tử. Hiđro hóa hoàn toàn licopen được hiđrocacbon C40H82. Vậy licopen cóA. 1 vòng; 12 nối đôi. B. 1 vòng; 5 nối đôi. C. 4 vòng; 5 nối đôi. D. mạch hở; 13 nối đôi.Câu 29: Metol C10H20O và menton C10H18O chúng đều có trong tinh dầu bạc hà. Biết phân tử metol không có nối đôi, còn phân tử menton có 1 nối đôi. Vậy kết luận nào sau đây là đúng ?A. Metol và menton đều có cấu tạo vòng. B. Metol có cấu tạo vòng, menton có cấu tạo mạch hởC. Metol và menton đều có cấu tạo mạch hở. D. Metol có cấu tạo mạch hở, menton có cấu tạo vòngCâu 30: Trong hợp chất CxHyOz thì y luôn luôn chẵn và y ≤ 2x+2 là do:A. a ≥ 0 (a là tổng số liên kết π và vòng trong phân tử)B. z ≥ 0 (mỗi nguyên tử oxi tạo được 2 liên kết)C. mỗi nguyên tử cacbon chỉ tạo được 4 liên kếtD. cacbon và oxi đều có hóa trị là những số chẵnCâu 31: Tổng số liên kết π và vòng ứng với công thức C5H9O2Cl là:A. 0. B. 1. C. 2. D. 3.Câu 32: Tổng số liên kết π và vòng ứng với công thức C5H12O2 là:A. 0. B. 1. C. 2. D. 3.Câu 33: Công thức tổng quát của dẫn xuất điclo mạch hở có chứa một liên kết ba trong phân tử làA. CnH2n-2Cl2. B. CnH2n-4Cl2. C. CnH2nCl2. D. CnH2n-6Cl2.Câu 34: Công thức tổng quát của dẫn xuất đibrom không no mạch hở chứa a liên kết π làA. CnH2n+2-2aBr2. B. CnH2n-2aBr2. C. CnH2n-2-2aBr2. D. CnH2n+2+2aBr2.Câu 35: Hợp chất hữu cơ có công thức tổng quát CnH2n+2O2 thuộc loạiA. ancol hoặc ete no, mạch hở, hai chức. B. anđehit hoặc xeton no, mạch hở, hai chức.C. axit hoặc este no, đơn chức, mạch hở. D. hiđroxicacbonyl no, mạch hở.Câu 36: Ancol no mạch hở có công thức tổng quát chính xác nhất làA. R(OH)m. B. CnH2n+2Om. C. CnH2n+1OH. D. CnH2n+2-m(OH)m.Câu 37: Công thức tổng quát của anđehit đơn chức mạch hở có 1 liên kết đôi C=C là:A. CnH2n+1CHO. B. CnH2nCHO. C. CnH2n-1CHO. D. CnH2n-3CHO.Câu 38: Anđehit mạch hở có công thức tổng quát CnH2n-2O thuộc loạiA. anđehit đơn chức no.B. anđehit đơn chức chứa một liên kết đôi trong gốc hiđrocacbon.C. anđehit đơn chức chứa hai liên kết π trong gốc hiđrocacbon.D. anđehit đơn chức chứa ba liên kết π trong gốc hiđrocacbon. 5Câu 39: Công thức tổng quát của ancol đơn chức mạch hở có 2 nối đôi trong gốc hiđrocacbon làA. CnH2n-4O. B. CnH2n-2O. C. CnH2nO. D. CnH2n+2O.Câu 40: Anđehit mạch hở CnH2n – 4O2 có số lượng liên kết π trong gốc hiđrocacbon là:A. 0. B. 1. C. 2. D. 3.Câu 41: Công thức phân tử tổng quát của axit hai chức mạch hở chứa một liên kết đôi trong gốc hiđrocacbon là:A. CnH2n-4O4. B. CnH2n-2O4. C. CnH2n-6O4. D. CnH2nO4.Câu 42: Axit mạch hở CnH2n – 4O2 có số lượng liên kết π trong gốc hiđrocacbon là:A. 0. B. 1. C. 2. D. 3.Câu 43: Tổng số liên kết π và vòng trong phân tử axit benzoic là: A. 3. B. 4. C. 5. D. 6.Câu 44: Số lượng đồng phân ứng với công thức phân tử C6H14A. 6. B. 7. C. 4. D. 5.Câu 45: Số lượng đồng phân mạch hở ứng với công thức phân tử C5H10 là:A. 2. B. 3. C. 6. D. 5.Câu 46: Số lượng đồng phân cấu tạo ứng với công thức phân tử C5H10 là:A. 7. B. 8. C. 9. D. 10.Câu 47: Số lượng đồng phân mạch hở ứng với công thức phân tử C5H8 là:A. 7. B. 8. C. 9. D. 10.Câu 48: Số lượng đồng phân chứa vòng benzen ứng với công thức phân tử C9H12 là:A. 7. B. 8. C. 9. D. 10.Câu 49: Số lượng đồng phân chứa vòng benzen ứng với công thức phân tử C9H10 là:A. 7. B. 8. C. 9. D. 6.Câu 50: Số lượng đồng phân ứng với công thức phân tử C3H5Br3 là:A. 3. B. 4. C. 5. D. 6.Câu 51: Số lượng đồng phân ứng với công thức phân tử C3H5Cl là:A. 3. B. 4. C. 5. D. 6.Câu 52: Hợp chất C4H10O có số đồng phân ancol và tổng số đồng phân là:A. 7 và 4. B. 4 và 7. C. 8 và 8. D. 10 và 10.Câu 53: Số lượng đồng phân mạch hở ứng với công thức phân tử C3H6O là:A. 2. B. 3. C. 4. D. 5.Câu 54: Số lượng đồng phân mạch hở ứng với công thức phân tử C4H6O2 tác dụng được với NaHCO3 là:A. 2. B. 3. C. 4. D. 5.Câu 55: Số lượng đồng phân ứng với công thức phân tử C4H11N là:A. 7. B. 8. C. 9. D. 10.Câu 56: Một hợp chất hữu cơ X có khối lượng phân tử là 26. Đem đốt X chỉ thu được CO2 và H2O. CTPT của X là:A. C2H6. B. C2H4. C. C2H2. D. CH2O.Câu 57: Một hợp chất hữu cơ A có M = 74. Đốt cháy A bằng oxi thu được khí CO2 và H2O. Có bao nhiêu công thức phân tử phù hợp với A?A. 4. B. 2. C. 3. D. A.1.Câu 58: Một hợp chất hữu cơ A có tỉ khối so với không khí bằng bằng 2. Đốt cháy hoàn toàn A bằng khí O2 thu được CO2 và H2O. Có bao nhiêu công thức phân tử phù hợp với A ?A. 2. B. A. 1. C. 3. D. 4.Câu 59: Hợp chất X có thành phần % về khối lượng : C (85,8%) và H (14,2%). Hợp chất X làA. C3H8. B. C4H10. C. C4H8. D. kết quả khác.Câu 60: Hợp chất X có %C = 54,54% ; %H = 9,1%, còn lại là oxi. Khối lượng phân tử của X bằng 88. CTPT của X là:A. C4H10O. B. C5H12O. C. C4H10O2. D. C4H8O2.Câu 61: Phân tích hợp chất hữu cơ X thấy cứ 3 phần khối lượng cacbon lại có 1 phần khối lượng hiđro, 7 phần khối lượng nitơ và 8 phần lưu huỳnh. Trong CTPT của X chỉ có 1 nguyên tử S, vậy CTPT của X làA. CH4NS. B. C2H2N2S. C. C2H6NS. D. CH4N2S.Câu 62: a. Hợp chất X có CTĐGN là CH3O. CTPT nào sau đây ứng với X ?A. C3H9O3. B. C2H6O2. C. C2H6O. D. CH3O. 6b. Công thức thực nghiệm của chất hữu cơ có dạng (CH3Cl)n thì công thức phân tử của hợp chất làA. CH3Cl. B. C2H6Cl2. C. C2H5Cl. D. C3H9Cl3.Câu 63: Một hợp chất hữu cơ gồm C, H, O ; trong đó cacbon chiếm 61,22% về khối lượng. Công thức phân tử của hợp chất là:A. C3H6O2. B. C2H2O3. C. C5H6O2. D. C4H10O.Câu 64: Chất hữu cơ X có M = 123 và khối lượng C, H, O và N trong phân tử theo thứ tự tỉ lệ với 72 : 5 : 32 : 14. CTPT của X là:A. C6H14O2N. B. C6H6ON2. C. C6H12ON. D. C6H5O2N.Câu 65: Đốt cháy hoàn toàn 0,6 gam hợp chất hữu cơ X rồi cho sản phẩm cháy qua bình đựng dung dịch Ca(OH)2 dư thấy có 2 gam kết tủa và khối lượng bình tăng thêm 1,24 gam. Tỉ khối của X so với H2 bằng 15. CTPT của X là:A. C2H6O. B. CH2O. C. C2H4O. D. CH2O2.Câu 66: Khi đốt 1 lít khí X cần 6 lít O2 thu được 4 lít CO2 và 5 lít hơi H2O (các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất). CTPT của X là:A. C4H10O. B. C4H8O2. C. C4H10O2. D. C3H8O.Câu 67: Đốt cháy hoàn toàn 3 gam hợp chất hữu cơ X thu được 4,4 gam CO2 và 1,8 gam H2O. Biết tỉ khối của X so với He (MHe = 4) là 7,5. CTPT của X là:A. CH2O2. B. C2H6. C. C2H4O. D. CH2O.Câu 68: Đốt cháy 1 lít hơi hiđrocacbon với một thể tích không khí (lượng dư). Hỗn hợp khí thu được sau khi hơi H2O ngưng tụ có thể tích là 18,5 lít, cho qua dung dịch KOH dư còn 16,5 lít, cho hỗn hợp khí đi qua ống đựng photpho dư thì còn lại 16 lít. Xác định CTPT của hợp chất trên biết các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất và O2 chiếm 1/5 không khí, còn lại là N2.A. C2H6. B. C2H4. C. C3H8. D. C2H2.Câu 69: Đốt 0,15 mol một hợp chất hữu cơ thu được 6,72 lít CO2 (đktc) và 5,4 gam H2O. Mặt khác đốt 1 thể tích hơi chất đó cần 2,5 thể tích O2. Các thể tích đo ở cùng điều kiện nhiệt độ, áp suất. CTPT của hợp chất đó là:A. C2H6O2. B. C2H6O. C. C2H4O2. D. C2H4O.Câu 70: Đốt cháy hoàn toàn một hợp chất hữu cơ X (C, H, N) bằng lượng không khí vừa đủ (gồm 1/5 thể tích O2, còn lại là N2) được khí CO2 , H2O và N2. Cho toàn bộ sản phẩm cháy qua bình đựng dung dịch Ba(OH)2 dư thấy có 39,4 gam kết tủa, khối lượng dung dịch giảm đi 24,3 gam. Khí thoát ra khỏi bình có thể tích 34,72 lít (đktc). Biết 2OXd< 2. CTPT của X là:A. C2H7N. B. C2H8N. C. C2H7N2. D. C2H4N2.Câu 71: Oxi hóa hoàn toàn 4,02 gam một hợp chất hữu cơ X chỉ thu được 3,18 gam Na2CO3 và 0,672 lít khí CO2. Cấu tạo đơn giản nhất của X là:A. CO2Na. B. CO2Na2. C. C3O2Na. D. C2O2Na.Câu 72: Đốt cháy hoàn toàn một hiđrocacbon trong 0,5 lít hỗn hợp của nó với CO2 bằng 2,5 lít O2 thu được 3,4 lít khí. Hỗn hợp này sau khi ngưng tụ hết hơi nước còn 1,8 lít, tiếp tục cho hỗn hợp khí còn lại qua dung dịch kiềm dư thì còn lại 0,5 lít khí. Các thể tích được đo ở cùng điều kiện nhiệt độ, áp suất. CTPT của hiđrocacbon là:A. C4H10. B. C3H8. C. C4H8. D. C3H6.Câu 73: Đốt cháy hoàn toàn 1,605 gam hợp chất hữu cơ A thu được 4,62 gam CO2 ; 1,215 gam H2O và 168 ml N2 (đktc). Tỉ khối hơi của A so với không khí không vượt quá 4. Công thức phân tử của A là:A. C5H5N. B. C6H9N. C. C7H9N. D. C6H7N.Câu 74: Oxi hóa hoàn toàn 6,15 gam hợp chất hữu cơ X thu được 2,25 gam H2O ; 6,72 lít CO2 và 0,56 lít N2 (đkc). Phần trăm khối lượng của C, H, N và O trong X lần lượt là:A. 58,5% ; 4,1% ; 11,4% ; 26%. B. 48,9% ; 15,8% ; 35,3% ; 0%.C. 49,5% ; 9,8% ; 15,5% ; 25,2%. D. 59,1 % ; 17,4% ; 23,5% ; 0%.Câu 75: Phân tích 0,31gam hợp chất hữu cơ X chỉ chứa C, H, N tạo thành 0,44 gam CO2. Mặt khác, nếu phân tích 0,31 gam X để toàn bộ N trong X chuyển thành NH3 rồi dẫn NH3 vừa tạo thành vào 100 ml dung dịch H2SO4 0,4M thì phần axit dư được trung hòa bởi 50 ml dung dịch NaOH 1,4M. Biết 1 lít hơi chất X (đktc) nặng 1,38 gam. CTPT của X là:A. CH5N. B. C2H5N2. C. C2H5N. D. CH6N. 7Câu 76: Đốt cháy 200 ml hơi một hợp chất hữu cơ X chứa C, H, O trong 900 ml O2, thể tích hỗn hợp khí thu được là 1,3 lít. Sau khi ngưng tụ hơi nước chỉ còn 700 ml. Tiếp theo cho qua dung dịch KOH dư chỉ còn 100 ml khí bay ra. Các thể tích khí đo ở cùng điều kiện nhiệt độ, áp suất. CTPT của Y là:A. C3H6O. B. C3H8O2. C. C3H8O. D. C3H6O2.Câu 77: Phân tích 1,5 gam chất hữu cơ X thu được 1,76 gam CO2 ; 0,9 gam H2O và 112 ml N2 đo ở 0oC và 2 atm. Nếu hóa hơi cũng 1,5 gam chất Z ở 127o C và 1,64 atm người ta thu được 0,4 lít khí chất Z. CTPT của X là:A. C2H5ON. B. C6H5ON2. C. C2H5O2N. D. C2H6O2N.Câu 78: Đốt cháy hoàn toàn một thể tích hơi hợp chất hữu cơ A cần 10 thể tích oxi (đo cùng điều kiện nhiệt độ và áp suất), sản phẩm thu được chỉ gồm CO2 và H2O với mCO2 : mH2O = 44 : 9. Biết MA < 150. A có công thức phân tử là: A. C4H6O. B. C8H8O. C. C8H8. D. C2H2.Câu 79: Cho 400 ml một hỗn hợp gồm nitơ và một hiđrocacbon vào 900 ml oxi (dư) rồi đốt. Thể tích hỗn hợp thu được sau khi đốt là 1,4 lít. Sau khi cho nước ngưng tụ còn 800 ml hỗn hợp, người ta cho lội qua dung dịch KOH thấy còn 400 ml khí. Các thể tích khí đều đo ở cùng điều kiện nhiệt độ, áp suất. Công thức phân tử của chất hữu cơ là: A. C3H8. B. C2H4. C. C2H2. D. C2H6.Câu 80: Đốt cháy 0,282 gam hợp chất hữu cơ X, cho sản phẩm đi qua các bình đựng CaCl2 khan và KOH dư. Thấy bình đựng CaCl2 tăng thêm 0,194 gam còn bình đựng KOH tăng thêm 0,8 gam. Mặt khác nếu đốt cháy 0,186 gam chất X thì thu được 22,4 ml khí N2 (ở đktc). Biết rằng hợp chất X chỉ chứa một nguyên tử nitơ. Công thức phân tử của hợp chất X là: A. C6H6N2. B. C6H7N. C. C6H9N. D. C5H7N.Câu 81: Đốt cháy hoàn toàn hợp chất hữu cơ chứa C, H, Cl sinh ra 0,22 gam CO2, 0,09 gam H2O. Mặt khác khi xác định clo trong hợp chất đó bằng dung dịch AgNO3 người ta thu được 1,435 gam AgCl. Tỉ khối hơi của hợp chất so với hiđro bằng 42,5. Công thức phân tử của hợp chất là: A. CH3Cl. B. C2H5Cl. C. CH2Cl2. D. C2H4Cl2.Câu 82: Đốt cháy hoàn toàn 0,4524 gam hợp chất A sinh ra 0,3318 gam CO2 và 0,2714 gam H2O. Đun nóng 0,3682 gam chất A với vôi tôi xút để chuyển tất cả nitơ trong A thành amoniac, rồi dẫn khí NH3 vào 20 ml dung dịch H2SO4 0,5 M. Để trung hoà axit còn dư sau khi tác dụng với NH3 cần dùng 7,7 ml dung dịch NaOH 1M. Biết MA= 60. Công thức phân tử của A là: A. CH4ON2. B. C2H7N. C. C3H9N. D. CH4ON.Câu 83*: Đốt cháy hoàn toàn 0,01 mol chất hữu cơ X cần vừa đủ 0,616 lít O2. Sau thí nghiệm thu được hỗn hợp sản phẩm Y gồm : CO2, N2 và hơi H2O. Làm lạnh để ngưng tụ hơi H2O chỉ còn 0,56 lít hỗn hợp khí Z (có tỉ khối hơi với H2 là 20,4). Biết thể tích các khí đều đo ở đktc. Công thức phân tử X là: A. C2H5ON. B. C2H5O2N. C. C2H7O2N. D. A hoặc C.Câu 84: X là một ancol no, mạch hở. Để đốt cháy 0,05 mol X cần 4 gam oxi. X có công thức là:A. C3H5(OH)3. B. C3H6(OH)2. C. C2H4(OH)2. D. C4H8(OH)2.Câu 85: Khi đốt cháy hoàn toàn một amin đơn chức X, thu được 16,80 lít khí CO2 ; 2,80 lít N2 (các thể tích đo ở đktc) và 20,25 gam H2O. CTPT của X là: A. C4H9N. B. C3H7N. C. C2H7N. D. C3H9N.Câu 86: Đốt cháy hoàn toàn m gam một amin X bằng lượng không khí vừa đủ thu được 17,6 gam CO2, 12,6 gam H2O và 69,44 lít N2 (đktc). Giả thiết không khí chỉ gồm N2 và O2 trong đó oxi chiếm 20% thể tích không khí. X có công thức là:A. C2H5NH2. B. C3H7NH2. C. CH3NH2. D. C4H9NH2.Câu 87: Trong một bình kín chứa hơi este no đơn chức hở A và một lượng O2 gấp đôi lượng O2 cần thiết để đốt cháy hết A ở nhiệt độ 140oC và áp suất 0,8 atm. Đốt cháy hoàn toàn A rồi đưa về nhiệt độ ban đầu, áp suất trong bình lúc này là 0,95 atm. A có công thức phân tử là:A. C2H4O2. B. C3H6O2. C. C4H8O2. D. C5H10O2.Câu 88: Đốt cháy hoàn toàn 0,12 mol chất hữu cơ X mạch hở cần dùng 10,08 lít khí O2 (đktc). Dẫn toàn bộ sản phẩm cháy (gồm CO2, H2O và N2) qua bình đựng dung dịch Ba(OH)2 dư, thấy khối lượng bình tăng 23,4 gam và có 70,92 gam kết tủa. Khí thoát ra khỏi bình có thể tích 1,344 lít (đktc). Công thức phân tử của X là:A. C2H5O2N. B. C3H5O2N. C. C3H7O2N. D. C2H7O2N. 8Câu 89: Đốt cháy hoàn toàn 0,1 mol chất X cần 6,16 lít khí O2 (đktc), thu được 13,44 lít (đktc) hỗn hợp CO2, N2 và hơi nước. Sau khi ngưng tụ hết hơi nước, còn lại 5,6 lít khí (đktc) có tỉ khối so với hiđro là 20,4. Công thức phân tử của X là:A. C2H7O2N. B. C3H7O2N. C. C3H9O2N. D. C4H9N.Câu 90: Đốt cháy hoàn toàn 0,1 mol một ancol mạch hở ba lần chứa một liên kết ba trong gốc hiđrocacbon thu được 0,6 mol CO2. Công thức phân tử của ancol đó là:A. C6H14O3. B. C6H12O3. C. C6H10O3. D. C6H8O3.Câu 91: Đốt cháy hoàn toàn 1,18 gam chất Y (CxHyN) bằng một lượng không khí vừa đủ. Dẫn toàn bộ hỗn hợp khí sau phản ứng vào bình đựng dung dịch Ca(OH)2 dư, thu được 6 gam kết tủa và có 9,632 lít khí (đktc) duy nhất thoát ra khỏi bình. Biết không khí chứa 20% oxi và 80% nitơ về thể tích. Công thức phân tử của Y là:A. C2H7N. B. C3H9N. C. C4H11N. D. C4H9N.Câu 92: Phân tích 1,47 gam chất hữu cơ Y (C, H, O) bằng CuO thì thu được 2,156 gam CO2 và lượng CuO giảm 1,568 gam. CTĐGN của Y là: A. CH3O. B. CH2O. C. C2H3O. D. C2H3O2.Câu 93: Đốt cháy hoàn toàn một hợp chất hữu cơ đơn chức X thu được sản phẩm cháy chỉ gồm CO2 và H2O với tỷ lệ khối lượng tương ứng là 44 : 27. Công thức phân tử của X là:A. C2H6. B. C2H6O. C. C2H6O2. D. C2H4O.Câu 94: Một hợp chất hữu cơ Y khi đốt cháy thu được CO2 và H2O có số mol bằng nhau và lượng oxi cần dùng bằng 4 lần số mol của Y. Công thức phân tử của Y là:A. C2H6O. B. C4H8O. C. C3H6O. D. C3H6O2.Câu 95: Đốt cháy hoàn toàn 0,2 mol một axit cacboxylic no 2 lần thu được 1,2 mol CO2. Công thức phân tử của axit đó là: A. C6H14O4. B. C6H12O4. C. C6H10O4. D. C6H8O4.Câu 96: Đốt cháy hoàn toàn 5,8 gam một hợp chất hữu cơ đơn chức X cần 8,96 lít khí O2 (đktc), thu được CO2 và H2O có số mol bằng nhau. CTĐGN của X là: A. C2H4O. B. C3H6O. C. C4H8O. D. C5H10O.Câu 97: Đốt cháy hoàn toàn 0,2 mol hiđrocacbon X. Hấp thụ toàn bộ sản phẩm cháy vào nước vôi trong được 20 gam kết tủa. Lọc bỏ kết tủa rồi đun nóng phần nước lọc lại có 10 gam kết tủa nữa. Vậy X không thể là:A. C2H6. B. C2H4. C. CH4. D. C2H2.Câu 98: Hỗn hợp X gồm một số hiđrocacbon là đồng đẳng kế tiếp. Tổng khối lượng phân tử của các hiđrocacbon trong A là 252, trong đó khối lượng phân tử của hiđrocacbon nặng nhất bằng 2 lần khối lượng phân tử của hiđrocacbon nhẹ nhất. Công thức phân tử của hiđrocacbon nhẹ nhất và số lượng hiđrocacbon trong X là:A. C3H6 và 4. B. C2H4 và 5. C. C3H8 và 4. D. C2H6 và 5.Câu 99: Đốt cháy hoàn toàn 5,80 gam chất X thu được 2,65 gam Na2CO3 ; 2,26 gam H2O và 12,10 gam CO2. Công thức phân tử của X là:A. C6H5O2Na. B. C6H5ONa. C. C7H7O2Na. D. C7H7ONa.Câu 100: Đốt cháy hoàn toàn 1,88 gam hợp chất hữu cơ Z (chứa C, H, O) cần 1,904 lít khí O2 (đktc), thu được CO2 và H2O với tỷ lệ mol tương ứng là 4 : 3. Công thức phân tử của Z là:A. C4H6O2. B. C8H12O4. C. C4H6O3. D. C8H12O5. 9CHUYÊN ĐỀ 2 : HIĐROCACBON NOCâu 1: Hợp chất hữu cơ X có tên gọi là: 2 - clo - 3 - metylpentan. Công thức cấu tạo của X là: A. CH3CH2CH(Cl)CH(CH3)2.B. CH3CH(Cl)CH(CH3)CH2CH3. C. CH3CH2CH(CH3)CH2CH2Cl. D. CH3CH(Cl)CH3CH(CH3)CH3.Câu 2: Có bao nhiêu đồng phân cấu tạo có công thức phân tử C5H12 ?A. 3 đồng phân. B. 4 đồng phân. C. 5 đồng phân. D. 6 đồng phânCâu 3: Có bao nhiêu đồng phân cấu tạo có công thức phân tử C6H14 ?A. 3 đồng phân. B. 4 đồng phân. C. 5 đồng phân. D. 6 đồng phânCâu 4: Có bao nhiêu đồng phân cấu tạo có công thức phân tử C4H9Cl ?A. 3 đồng phân. B. 4 đồng phân. C. 5 đồng phân. D. 6 đồng phân.Câu 5: Có bao nhiêu đồng phân cấu tạo có công thức phân tử C5H11Cl ?A. 6 đồng phân. B. 7 đồng phân. C. 5 đồng phân. D. 8 đồng phân.Câu 6: Phần trăm khối lượng cacbon trong phân tử ankan Y bằng 83,33%. Công thức phân tử của Y là: A. C2H6. B. C3H8. C. C4H10. D. C5H12. Câu 7: Công thức đơn giản nhất của hiđrocacbon M là CnH2n+1. M thuộc dãy đồng đẳng nào ? A. ankan. B. không đủ dữ kiện để xác định. C. ankan hoặc xicloankan. D. xicloankan. Câu 8: a. 2,2,3,3-tetrametylbutan có bao nhiêu nguyên tử C và H trong phân tử ?A. 8C,16H. B. 8C,14H. C. 6C, 12H. D. 8C,18H.b. Cho ankan có CTCT là: (CH3)2CHCH2C(CH3)3. Tên gọi của ankan là:A. 2,2,4-trimetylpentan. B. 2,4-trimetylpetan.C. 2,4,4-trimetylpentan. D. 2-đimetyl-4-metylpentan.Câu 9: Phản ứng đặc trưng của hiđrocacbon no làA. Phản ứng tách. B. Phản ứng thế. C. Phản ứng cộng. D. Cả A, B và C.Câu 10: Cho iso-pentan tác dụng với Cl2 theo tỉ lệ số mol 1 : 1, số sản phẩm monoclo tối đa thu được là:A. 2. B. 3. C. 5. D. 4.Câu 11: Iso-hexan tác dụng với clo (có chiếu sáng) có thể tạo tối đa bao nhiêu dẫn xuất monoclo ?A. 3. B. 4. C. 5. D. 6Câu 12: Khi cho 2-metylbutan tác dụng với Cl2 theo tỷ lệ mol 1:1 thì tạo ra sản phẩm chính là:A. 1-clo-2-metylbutan. B. 2-clo-2-metylbutan. C. 2-clo-3-metylbutan. D. 1-clo-3-metylbutan.Câu 13: Khi clo hóa C5H12 với tỷ lệ mol 1:1 thu được 3 sản phẩm thế monoclo. Danh pháp IUPAC của ankan đó là:A. 2,2-đimetylpropan. B. 2-metylbutan. C. pentan. D. 2-đimetylpropan.Câu 14: Khi clo hóa metan thu được một sản phẩm thế chứa 89,12% clo về khối lượng. Công thức của sản phẩm là:A. CH3Cl. B. CH2Cl2. C. CHCl3. D. CCl4.Câu 15: Cho 4 chất: metan, etan, propan và n-butan. Số lượng chất tạo được một sản phẩm thế monoclo duy nhất là:A. 1. B. 2. C. 3. D. 4.Câu 16: khi clo hóa một ankan có công thức phân tử C6H14, người ta chỉ thu được 2 sản phẩm thế monoclo. Danh pháp IUPAC của ankan đó là:A. 2,2-đimetylbutan. B. 2-metylpentan. C. n-hexan. D. 2,3-đimetylbutan.Câu 17: Khi clo hóa hỗn hợp 2 ankan, người ta chỉ thu được 3 sản phẩm thế monoclo. Tên gọi của 2 ankan đó là:A. etan và propan. B. propan và iso-butan.C. iso-butan và n-pentan. D. neo-pentan và etan.Câu 18: Khi brom hóa một ankan chỉ thu được một dẫn xuất monobrom duy nhất có tỉ khối hơi đối với hiđro là 75,5. Tên của ankan đó là: A. 3,3-đimetylhecxan. C. isopentan.B. 2,2-đimetylpropan. D. 2,2,3-trimetylpentanCâu 19: Khi cho ankan X (trong phân tử có phần trăm khối lượng cacbon bằng 83,72%) tác dụng với clo theo tỉ lệ số mol 1:1 (trong điều kiện chiếu sáng) chỉ thu được 2 dẫn xuất monoclo đồng phân của nhau. 10 . đều co cấu tạo vòng. B. Metol co cấu tạo vòng, menton co cấu tạo mạch hởC. Metol và menton đều co cấu tạo mạch hở. D. Metol co cấu. menton C10H18O chúng đều co trong tinh dầu bạc hà. Biết phân tử metol không co nối đôi, co n phân tử menton co 1 nối đôi. Vậy kết luận

— Xem thêm —

Xem thêm: Bai tap trac nghiem hoa huu co 11, Bai tap trac nghiem hoa huu co 11, Bai tap trac nghiem hoa huu co 11

Lên đầu trang

Mục lục

Từ khóa liên quan

Đăng ký

Generate time = 0.109227895737 s. Memory usage = 13.98 MB